Aryl chlorides
eMolecules 849807-09-6 | Methyl 2-chloroquinoline-6-carboxylate | MFCD17215626 | 1g
Ambeed | Methyl 2-chloroquinoline-6-carboxylate | 1g | 510413665 | A413112 | 849807-09-6 | MFCD17215626 | 221.640 | C11H8ClNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 g/mol | C6H4Cl2 | 50g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
eMolecules 129822-46-4 | 1-BOC-4-Chloroindole | Combi-Blocks | MFCD09025758 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2c(Cl)cccc12 | 1g | 117535390
1-BOC-4-Chloroindole | Combi-Blocks | 129822-46-4 | MFCD09025758 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2c(Cl)cccc12 | 1g | 117535390
eMolecules 356783-15-8 | ChemScene | 36-Dichloropyrazine-2-carboxylic acid | 100mg | 632277529 | CS-0042774 | MFCD14581978 | 192.98 | C5H2Cl2N2O2
Medchem Express | Tris-NTA | 5mg | 719836940 | HY-D1288A | 862778-60-7 | 1049.051 | C43H68N8O22
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chem-Impex International, Inc. 5-Chloro-2-cyanopyridine | MFCD03788835 | 25G
5-Chloro-2-cyanopyridine, MFCD03788835, 25G
Sigma Aldrich Fine Chemicals Biosciences 1,2-Dichlorobenzene | 95-50-1 | MFCD00000535 | 4L
1,2-Dichlorobenzene | Purity: 99% | MW:147 | 95-50-1 | MFCD00000535 | 4L
eMolecules 129822-48-6 | 1-Boc-5-chloroindole | Combi-Blocks | MFCD05865201 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2cc(Cl)ccc12 | 1g | 117535393
1-Boc-5-chloroindole | Combi-Blocks | 129822-48-6 | MFCD05865201 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2cc(Cl)ccc12 | 1g | 117535393
Aobchem 4-Bromo-2 3-dichlorotoluene | ≥95% | CAS 1807029-15-7 | C7H5BrCl2 | 5g
4-Bromo-2 3-dichlorotoluene | ≥95% | CAS 1807029-15-7 | C7H5BrCl2 | 5g
Aobchem 3 5-Dichlorotoluene | ≥97% | CAS 25186-47-4 | C7H6Cl2 | 5g
3 5-Dichlorotoluene | ≥97% | CAS 25186-47-4 | C7H6Cl2 | 5g
Aobchem 3-Bromo-2 4-dichlorotoluene | ≥97% | CAS 206559-41-3 | C7H5BrCl2 | 500mg
3-Bromo-2 4-dichlorotoluene | ≥97% | CAS 206559-41-3 | C7H5BrCl2 | 500mg
Aobchem 4 5-Dichlorobenzene-1 2-diol | ≥97% | CAS 3428-24-8 | C6H4Cl2O2 | 1g
4 5-Dichlorobenzene-1 2-diol | ≥97% | CAS 3428-24-8 | C6H4Cl2O2 | 1g
Aobchem 5-Bromo-2 4-dichlorotoluene | ≥97% | CAS 85072-41-9 | C7H5BrCl2 | 500mg
5-Bromo-2 4-dichlorotoluene | ≥97% | CAS 85072-41-9 | C7H5BrCl2 | 500mg
![eMolecules 61220-58-4 | 6-Chloroindole-3-acetonitrile | Chem-Impex | MFCD03428598 | 190.630 | C10H7ClN2 | 98.000 | Clc1ccc2c(CC#N)c[nH]c2c1 | 1g | 112755374](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502178222.JPG-250.jpg)
eMolecules 61220-58-4 | 6-Chloroindole-3-acetonitrile | Chem-Impex | MFCD03428598 | 190.630 | C10H7ClN2 | 98.000 | Clc1ccc2c(CC#N)c[nH]c2c1 | 1g | 112755374
6-Chloroindole-3-acetonitrile | Chem-Impex | 61220-58-4 | MFCD03428598 | 190.630 | C10H7ClN2 | 98.000 | Clc1ccc2c(CC#N)c[nH]c2c1 | 1g | 112755374
Frontier Specialty Chemicals 5g 3-Chloro-4-cyanopyridine, 68325-15-5 MFCD05663706
3-Chloro-4-cyanopyridine CAS: 68325-15-5 MFCD05663706 Building Blocks Pyridine Cyano, Halogenated
Matrix Scientific 2-CHLORO-4-(TRIFLUOROMETHY-25G
2-Chloro-4-(trifluoromethyl)pyrimidine, 98%; 25g,C5H2ClF3N2, MFCD00115111, mw 182.53, [33034-67-2]